C21H18F3N3O4 — CID 35650213
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 35650213) has the molecular formula C21H18F3N3O4 and a molecular weight of 433.39 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 35650213 |
| Molecular Formula | C21H18F3N3O4 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | N#CCCN(C(=O)COC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H18F3N3O4/c22-21(23,24)16-9-7-15(8-10-16)20(30)26-13-19(29)31-14-18(28)27(12-4-11-25)17-5-2-1-3-6-17/h1-3,5-10H,4,12-14H2,(H,26,30) |
| InChIKey | DAZLIIMHVOTRTJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |