C19H23F3N2O4 — CID 7880469
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 7880469) has the molecular formula C19H23F3N2O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 7880469 |
| Molecular Formula | C19H23F3N2O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | CC1CCC(NC(=O)COC(=O)CNC(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H23F3N2O4/c1-12-2-8-15(9-3-12)24-16(25)11-28-17(26)10-23-18(27)13-4-6-14(7-5-13)19(20,21)22/h4-7,12,15H,2-3,8-11H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | PICYSXFNVRPGOP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |