C19H26N2O5 — CID 8788243
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate (PubChem CID 8788243) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8788243 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-[(4-methoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCC(=O)NC2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C19H26N2O5/c1-13-3-7-15(8-4-13)21-17(22)12-26-18(23)11-20-19(24)14-5-9-16(25-2)10-6-14/h5-6,9-10,13,15H,3-4,7-8,11-12H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | QNGJOTFQMYVWFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |