C15H15F3N2O4 — CID 7880563
[2-(cyclopropylamino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 7880563) has the molecular formula C15H15F3N2O4 and a molecular weight of 344.29 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 7880563 |
| Molecular Formula | C15H15F3N2O4 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1)NC1CC1 |
| InChI | InChI=1S/C15H15F3N2O4/c16-15(17,18)10-3-1-9(2-4-10)14(23)19-7-13(22)24-8-12(21)20-11-5-6-11/h1-4,11H,5-8H2,(H,19,23)(H,20,21) |
| InChIKey | REGDDCKPBDIDMJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |