C22H22N2O6S2 — CID 55320597
[1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 55320597) has the molecular formula C22H22N2O6S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 55320597 |
| Molecular Formula | C22H22N2O6S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | CC(OC(=O)CCNS(=O)(=O)c1cccs1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O6S2/c1-16(29-20(25)13-14-23-32(27,28)21-8-5-15-31-21)22(26)24-17-9-11-19(12-10-17)30-18-6-3-2-4-7-18/h2-12,15-16,23H,13-14H2,1H3,(H,24,26) |
| InChIKey | ACZZWGIOJBYYBR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |