C23H26N3O4S2+ — CID 2399709
(2R)-N-(4-phenoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide (PubChem CID 2399709) has the molecular formula C23H26N3O4S2+ and a molecular weight of 472.61 g/mol. Its IUPAC name is (2R)-N-(4-phenoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(4-phenoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 2399709 |
| Molecular Formula | C23H26N3O4S2+ |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (2R)-N-(4-phenoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(Oc2ccccc2)cc1)[NH+]1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-18(25-13-15-26(16-14-25)32(28,29)22-8-5-17-31-22)23(27)24-19-9-11-21(12-10-19)30-20-6-3-2-4-7-20/h2-12,17-18H,13-16H2,1H3,(H,24,27)/p+1/t18-/m1/s1 |
| InChIKey | IKFSRSLQOWCGHG-GOSISDBHSA-O |
| XLogP | 2.46 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |