C19H26N3O4S2+ — CID 9492918
(2R)-N-(2-ethoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide (PubChem CID 9492918) has the molecular formula C19H26N3O4S2+ and a molecular weight of 424.57 g/mol. Its IUPAC name is (2R)-N-(2-ethoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(2-ethoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 9492918 |
| Molecular Formula | C19H26N3O4S2+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (2R)-N-(2-ethoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
| SMILES | CCOc1ccccc1NC(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H25N3O4S2/c1-3-26-17-8-5-4-7-16(17)20-19(23)15(2)21-10-12-22(13-11-21)28(24,25)18-9-6-14-27-18/h4-9,14-15H,3,10-13H2,1-2H3,(H,20,23)/p+1/t15-/m1/s1 |
| InChIKey | XGPVPCVFIAABBT-OAHLLOKOSA-O |
| XLogP | 1.06 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |