C18H24N3O4S2+ — CID 8745319
(2S)-N-(3-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide (PubChem CID 8745319) has the molecular formula C18H24N3O4S2+ and a molecular weight of 410.54 g/mol. Its IUPAC name is (2S)-N-(3-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(3-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8745319 |
| Molecular Formula | C18H24N3O4S2+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (2S)-N-(3-methoxyphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
| SMILES | COc1cccc(NC(=O)[C@H](C)[NH+]2CCN(S(=O)(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-14(18(22)19-15-5-3-6-16(13-15)25-2)20-8-10-21(11-9-20)27(23,24)17-7-4-12-26-17/h3-7,12-14H,8-11H2,1-2H3,(H,19,22)/p+1/t14-/m0/s1 |
| InChIKey | FDQMYOBAEPBBOH-AWEZNQCLSA-O |
| XLogP | 0.67 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |