C12H12N2O4S2 — CID 95560374
1-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylurea (PubChem CID 95560374) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylurea.
| Compound Name | 1-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylurea |
|---|---|
| PubChem CID | 95560374 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-thiophen-2-ylsulfonylurea |
| SMILES | COc1cccc(NC(=O)NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C12H12N2O4S2/c1-18-10-5-2-4-9(8-10)13-12(15)14-20(16,17)11-6-3-7-19-11/h2-8H,1H3,(H2,13,14,15) |
| InChIKey | XKSXNGLCVUMBFB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |