C26H22N2O6S2 — CID 2402847
[(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 2402847) has the molecular formula C26H22N2O6S2 and a molecular weight of 522.60 g/mol. Its IUPAC name is [(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2402847 |
| Molecular Formula | C26H22N2O6S2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | [(1S)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | COc1cccc(NC(=O)[C@@H](OC(=O)c2ccccc2NS(=O)(=O)c2cccs2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H22N2O6S2/c1-33-20-12-7-11-19(17-20)27-25(29)24(18-9-3-2-4-10-18)34-26(30)21-13-5-6-14-22(21)28-36(31,32)23-15-8-16-35-23/h2-17,24,28H,1H3,(H,27,29)/t24-/m0/s1 |
| InChIKey | PIHGOYCYJTVKIQ-DEOSSOPVSA-N |
| XLogP | 5.09 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |