C28H23BrN2O6S — CID 4969062
[2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(4-bromophenyl)sulfonylamino]benzoate (PubChem CID 4969062) has the molecular formula C28H23BrN2O6S and a molecular weight of 595.47 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(4-bromophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(4-bromophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4969062 |
| Molecular Formula | C28H23BrN2O6S |
| Molecular Weight | 595.47 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-[(4-bromophenyl)sulfonylamino]benzoate |
| SMILES | COc1cccc(NC(=O)C(OC(=O)c2ccccc2NS(=O)(=O)c2ccc(Br)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H23BrN2O6S/c1-36-22-11-7-10-21(18-22)30-27(32)26(19-8-3-2-4-9-19)37-28(33)24-12-5-6-13-25(24)31-38(34,35)23-16-14-20(29)15-17-23/h2-18,26,31H,1H3,(H,30,32) |
| InChIKey | KVSQIIKHBLHDCS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |