C29H22N2O4S — CID 23766266
[2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 23766266) has the molecular formula C29H22N2O4S and a molecular weight of 494.57 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23766266 |
| Molecular Formula | C29H22N2O4S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | COc1cccc(NC(=O)C(OC(=O)c2cc(-c3cccs3)nc3ccccc23)c2ccccc2)c1 |
| InChI | InChI=1S/C29H22N2O4S/c1-34-21-12-7-11-20(17-21)30-28(32)27(19-9-3-2-4-10-19)35-29(33)23-18-25(26-15-8-16-36-26)31-24-14-6-5-13-22(23)24/h2-18,27H,1H3,(H,30,32) |
| InChIKey | INYMGGRYBKNUBH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |