C29H21NO4S — CID 126187868
[(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 126187868) has the molecular formula C29H21NO4S and a molecular weight of 479.56 g/mol. Its IUPAC name is [(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 126187868 |
| Molecular Formula | C29H21NO4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [(1S)-2-(4-methoxyphenyl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)[C@@H](OC(=O)c2cc(-c3cccs3)nc3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21NO4S/c1-33-21-15-13-19(14-16-21)27(31)28(20-8-3-2-4-9-20)34-29(32)23-18-25(26-12-7-17-35-26)30-24-11-6-5-10-22(23)24/h2-18,28H,1H3/t28-/m0/s1 |
| InChIKey | DDHOECVAHHIUOH-NDEPHWFRSA-N |
| XLogP | 6.75 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |