C30H20N2O3S — CID 4565709
[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 4565709) has the molecular formula C30H20N2O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4565709 |
| Molecular Formula | C30H20N2O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | O=C(OC(C(=O)c1c[nH]c2ccccc12)c1ccccc1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C30H20N2O3S/c33-28(23-18-31-24-13-6-4-12-21(23)24)29(19-9-2-1-3-10-19)35-30(34)22-17-26(27-15-8-16-36-27)32-25-14-7-5-11-20(22)25/h1-18,29,31H |
| InChIKey | FEDKULHLIHAULS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |