C23H16N4OS — CID 135501387
N-[(E)-1H-indol-3-ylmethylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 135501387) has the molecular formula C23H16N4OS and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 135501387 |
| Molecular Formula | C23H16N4OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1c[nH]c2ccccc12)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C23H16N4OS/c28-23(27-25-14-15-13-24-19-8-3-1-6-16(15)19)18-12-21(22-10-5-11-29-22)26-20-9-4-2-7-17(18)20/h1-14,24H,(H,27,28)/b25-14+ |
| InChIKey | PJVQUNGEKQYDCO-AFUMVMLFSA-N |
| XLogP | 5.21 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|