C25H21N3O5S — CID 4209915
[2,6-dimethoxy-4-[[(2-thiophen-2-ylquinoline-4-carbonyl)hydrazinylidene]methyl]phenyl] acetate (PubChem CID 4209915) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[[(2-thiophen-2-ylquinoline-4-carbonyl)hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[[(2-thiophen-2-ylquinoline-4-carbonyl)hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 4209915 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [2,6-dimethoxy-4-[[(2-thiophen-2-ylquinoline-4-carbonyl)hydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(C=NNC(=O)c2cc(-c3cccs3)nc3ccccc23)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C25H21N3O5S/c1-15(29)33-24-21(31-2)11-16(12-22(24)32-3)14-26-28-25(30)18-13-20(23-9-6-10-34-23)27-19-8-5-4-7-17(18)19/h4-14H,1-3H3,(H,28,30) |
| InChIKey | LNUVPEQOHHRBKQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|