C25H23N3O4S — CID 3309651
2-thiophen-2-yl-N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinoline-4-carboxamide (PubChem CID 3309651) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-thiophen-2-yl-N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3309651 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-thiophen-2-yl-N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinoline-4-carboxamide |
| SMILES | COc1cc(C(C)=NNC(=O)c2cc(-c3cccs3)nc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C25H23N3O4S/c1-15(16-12-21(30-2)24(32-4)22(13-16)31-3)27-28-25(29)18-14-20(23-10-7-11-33-23)26-19-9-6-5-8-17(18)19/h5-14H,1-4H3,(H,28,29) |
| InChIKey | FWJOKWOSYPVLDW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|