C26H21N5OS — CID 6874751
N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 6874751) has the molecular formula C26H21N5OS and a molecular weight of 451.56 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 6874751 |
| Molecular Formula | C26H21N5OS |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-[(E)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=N/NC(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C26H21N5OS/c1-17-22(18(2)31(30-17)19-9-4-3-5-10-19)16-27-29-26(32)21-15-24(25-13-8-14-33-25)28-23-12-7-6-11-20(21)23/h3-16H,1-2H3,(H,29,32)/b27-16+ |
| InChIKey | YANZTRCEKDTZDE-JVWAILMASA-N |
| XLogP | 5.53 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|