C19H24N3O4S2+ — CID 8745871
(2R)-N-(3-acetylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide (PubChem CID 8745871) has the molecular formula C19H24N3O4S2+ and a molecular weight of 422.55 g/mol. Its IUPAC name is (2R)-N-(3-acetylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(3-acetylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8745871 |
| Molecular Formula | C19H24N3O4S2+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (2R)-N-(3-acetylphenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)[NH+]2CCN(S(=O)(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-14(19(24)20-17-6-3-5-16(13-17)15(2)23)21-8-10-22(11-9-21)28(25,26)18-7-4-12-27-18/h3-7,12-14H,8-11H2,1-2H3,(H,20,24)/p+1/t14-/m1/s1 |
| InChIKey | WSCVGLBYTZBMJK-CQSZACIVSA-O |
| XLogP | 0.87 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |