C20H23ClN2O4S2 — CID 53119060
N-(3-acetylphenyl)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanamide (PubChem CID 53119060) has the molecular formula C20H23ClN2O4S2 and a molecular weight of 455.00 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanamide.
| Compound Name | N-(3-acetylphenyl)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 53119060 |
| Molecular Formula | C20H23ClN2O4S2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N-(3-acetylphenyl)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(C)C2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)c1 |
| InChI | InChI=1S/C20H23ClN2O4S2/c1-13(20(25)22-17-5-3-4-16(12-17)14(2)24)15-8-10-23(11-9-15)29(26,27)19-7-6-18(21)28-19/h3-7,12-13,15H,8-11H2,1-2H3,(H,22,25) |
| InChIKey | QSUVTZBIOJCLRK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |