C21H28ClN3O3S2 — CID 53119096
2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[[4-(dimethylamino)phenyl]methyl]propanamide (PubChem CID 53119096) has the molecular formula C21H28ClN3O3S2 and a molecular weight of 470.06 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[[4-(dimethylamino)phenyl]methyl]propanamide.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[[4-(dimethylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 53119096 |
| Molecular Formula | C21H28ClN3O3S2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[[4-(dimethylamino)phenyl]methyl]propanamide |
| SMILES | CC(C(=O)NCc1ccc(N(C)C)cc1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C21H28ClN3O3S2/c1-15(21(26)23-14-16-4-6-18(7-5-16)24(2)3)17-10-12-25(13-11-17)30(27,28)20-9-8-19(22)29-20/h4-9,15,17H,10-14H2,1-3H3,(H,23,26) |
| InChIKey | GQYKMFKSBDYTLX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|