C22H36ClN3O3S2 — CID 95088926
(2S)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]propanamide (PubChem CID 95088926) has the molecular formula C22H36ClN3O3S2 and a molecular weight of 490.14 g/mol. Its IUPAC name is (2S)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]propanamide.
| Compound Name | (2S)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 95088926 |
| Molecular Formula | C22H36ClN3O3S2 |
| Molecular Weight | 490.14 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (2S)-2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]propanamide |
| SMILES | C[C@H](C(=O)NCCCN(C)C1CCCCC1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C22H36ClN3O3S2/c1-17(22(27)24-13-6-14-25(2)19-7-4-3-5-8-19)18-11-15-26(16-12-18)31(28,29)21-10-9-20(23)30-21/h9-10,17-19H,3-8,11-16H2,1-2H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | XMGBXZCBOWDNOV-KRWDZBQOSA-N |
| XLogP | 4.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.14 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|