C20H23ClN2O5S2 — CID 53119039
methyl 2-[2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoylamino]benzoate (PubChem CID 53119039) has the molecular formula C20H23ClN2O5S2 and a molecular weight of 471.00 g/mol. Its IUPAC name is methyl 2-[2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoylamino]benzoate.
| Compound Name | methyl 2-[2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 53119039 |
| Molecular Formula | C20H23ClN2O5S2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | methyl 2-[2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]propanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C20H23ClN2O5S2/c1-13(19(24)22-16-6-4-3-5-15(16)20(25)28-2)14-9-11-23(12-10-14)30(26,27)18-8-7-17(21)29-18/h3-8,13-14H,9-12H2,1-2H3,(H,22,24) |
| InChIKey | NKDMPWSEOUQMQJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |