C17H25N2O2+ — CID 8903613
(2S)-N-(3-acetylphenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]propanamide (PubChem CID 8903613) has the molecular formula C17H25N2O2+ and a molecular weight of 289.40 g/mol. Its IUPAC name is (2S)-N-(3-acetylphenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-(3-acetylphenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8903613 |
| Molecular Formula | C17H25N2O2+ |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | (2S)-N-(3-acetylphenyl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@H](C)[NH+]2CCC[C@H](C)C2)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-12-6-5-9-19(11-12)13(2)17(21)18-16-8-4-7-15(10-16)14(3)20/h4,7-8,10,12-13H,5-6,9,11H2,1-3H3,(H,18,21)/p+1/t12-,13-/m0/s1 |
| InChIKey | FJNWYMRKGDNDLF-STQMWFEESA-O |
| XLogP | 1.53 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |