C20H26N3O4S+ — CID 9493902
(2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-methoxyphenyl)propanamide (PubChem CID 9493902) has the molecular formula C20H26N3O4S+ and a molecular weight of 404.51 g/mol. Its IUPAC name is (2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-methoxyphenyl)propanamide.
| Compound Name | (2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 9493902 |
| Molecular Formula | C20H26N3O4S+ |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](C)[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-16(20(24)21-17-8-10-18(27-2)11-9-17)22-12-14-23(15-13-22)28(25,26)19-6-4-3-5-7-19/h3-11,16H,12-15H2,1-2H3,(H,21,24)/p+1/t16-/m1/s1 |
| InChIKey | JDXLBDXOQJMWPS-MRXNPFEDSA-O |
| XLogP | 0.61 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |