C17H26N3O4S+ — CID 9493018
(2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide (PubChem CID 9493018) has the molecular formula C17H26N3O4S+ and a molecular weight of 368.48 g/mol. Its IUPAC name is (2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 9493018 |
| Molecular Formula | C17H26N3O4S+ |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2R)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O4S/c1-4-9-18-17(21)14(2)19-10-12-20(13-11-19)25(22,23)16-7-5-15(24-3)6-8-16/h4-8,14H,1,9-13H2,2-3H3,(H,18,21)/p+1/t14-/m1/s1 |
| InChIKey | MAXITDDTLPHDPP-CQSZACIVSA-O |
| XLogP | -0.72 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|