C18H28N3O4S+ — CID 9493105
(2R)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide (PubChem CID 9493105) has the molecular formula C18H28N3O4S+ and a molecular weight of 382.51 g/mol. Its IUPAC name is (2R)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 9493105 |
| Molecular Formula | C18H28N3O4S+ |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (2R)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)c2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O4S/c1-4-10-19-18(22)15(3)20-11-13-21(14-12-20)26(23,24)17-8-6-16(7-9-17)25-5-2/h4,6-9,15H,1,5,10-14H2,2-3H3,(H,19,22)/p+1/t15-/m1/s1 |
| InChIKey | BLOGIIPAJVRZNG-OAHLLOKOSA-O |
| XLogP | -0.33 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|