C15H22N3O3S+ — CID 8746787
(2S)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile (PubChem CID 8746787) has the molecular formula C15H22N3O3S+ and a molecular weight of 324.43 g/mol. Its IUPAC name is (2S)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile.
| Compound Name | (2S)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile |
|---|---|
| PubChem CID | 8746787 |
| Molecular Formula | C15H22N3O3S+ |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2S)-2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-ium-1-yl]propanenitrile |
| SMILES | CCOc1ccc(S(=O)(=O)N2CC[NH+]([C@@H](C)C#N)CC2)cc1 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-21-14-4-6-15(7-5-14)22(19,20)18-10-8-17(9-11-18)13(2)12-16/h4-7,13H,3,8-11H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | GTQGKPGWHZZKDG-ZDUSSCGKSA-O |
| XLogP | -0.11 |
| TPSA | 74.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |