C17H20N3O2S+ — CID 8743070
(2S)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanenitrile (PubChem CID 8743070) has the molecular formula C17H20N3O2S+ and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanenitrile.
| Compound Name | (2S)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanenitrile |
|---|---|
| PubChem CID | 8743070 |
| Molecular Formula | C17H20N3O2S+ |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2S)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanenitrile |
| SMILES | C[C@@H](C#N)[NH+]1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C17H19N3O2S/c1-14(13-18)19-8-10-20(11-9-19)23(21,22)17-7-6-15-4-2-3-5-16(15)12-17/h2-7,12,14H,8-11H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | MFEWEEKMBKEFNS-AWEZNQCLSA-O |
| XLogP | 0.64 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |