C20H28N3O4S+ — CID 9493851
(2R)-N-(2-methoxyethyl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide (PubChem CID 9493851) has the molecular formula C20H28N3O4S+ and a molecular weight of 406.53 g/mol. Its IUPAC name is (2R)-N-(2-methoxyethyl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(2-methoxyethyl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 9493851 |
| Molecular Formula | C20H28N3O4S+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2R)-N-(2-methoxyethyl)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)propanamide |
| SMILES | COCCNC(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C20H27N3O4S/c1-16(20(24)21-9-14-27-2)22-10-12-23(13-11-22)28(25,26)19-8-7-17-5-3-4-6-18(17)15-19/h3-8,15-16H,9-14H2,1-2H3,(H,21,24)/p+1/t16-/m1/s1 |
| InChIKey | LZTAPFSRCZIJQW-MRXNPFEDSA-O |
| XLogP | -0.12 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|