C16H25ClN3O2+ — CID 9442622
(2R)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 9442622) has the molecular formula C16H25ClN3O2+ and a molecular weight of 326.85 g/mol. Its IUPAC name is (2R)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2R)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 9442622 |
| Molecular Formula | C16H25ClN3O2+ |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2R)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@@H](C)[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-13(16(21)18-6-11-22-2)19-7-9-20(10-8-19)15-5-3-4-14(17)12-15/h3-5,12-13H,6-11H2,1-2H3,(H,18,21)/p+1/t13-/m1/s1 |
| InChIKey | BYOHWMPRGKQIGF-CYBMUJFWSA-O |
| XLogP | 0.20 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|