C21H26ClN4O2+ — CID 9442798
(2S)-N-(benzylcarbamoyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9442798) has the molecular formula C21H26ClN4O2+ and a molecular weight of 401.92 g/mol. Its IUPAC name is (2S)-N-(benzylcarbamoyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-(benzylcarbamoyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9442798 |
| Molecular Formula | C21H26ClN4O2+ |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (2S)-N-(benzylcarbamoyl)-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC(=O)NCc1ccccc1)[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H25ClN4O2/c1-16(20(27)24-21(28)23-15-17-6-3-2-4-7-17)25-10-12-26(13-11-25)19-9-5-8-18(22)14-19/h2-9,14,16H,10-13,15H2,1H3,(H2,23,24,27,28)/p+1/t16-/m0/s1 |
| InChIKey | WBKHJFIVOUJRLO-INIZCTEOSA-O |
| XLogP | 1.46 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |