C21H27N4O2+ — CID 9250301
(2S)-N-(benzylcarbamoyl)-2-(4-phenylpiperazin-1-ium-1-yl)propanamide (PubChem CID 9250301) has the molecular formula C21H27N4O2+ and a molecular weight of 367.47 g/mol. Its IUPAC name is (2S)-N-(benzylcarbamoyl)-2-(4-phenylpiperazin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(benzylcarbamoyl)-2-(4-phenylpiperazin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 9250301 |
| Molecular Formula | C21H27N4O2+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2S)-N-(benzylcarbamoyl)-2-(4-phenylpiperazin-1-ium-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)NC(=O)NCc1ccccc1)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O2/c1-17(20(26)23-21(27)22-16-18-8-4-2-5-9-18)24-12-14-25(15-13-24)19-10-6-3-7-11-19/h2-11,17H,12-16H2,1H3,(H2,22,23,26,27)/p+1/t17-/m0/s1 |
| InChIKey | ORBDQBJPAMRENH-KRWDZBQOSA-O |
| XLogP | 0.81 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |