C19H21F3N3O+ — CID 2653989
(2S)-2-(4-phenylpiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 2653989) has the molecular formula C19H21F3N3O+ and a molecular weight of 364.39 g/mol. Its IUPAC name is (2S)-2-(4-phenylpiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-(4-phenylpiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 2653989 |
| Molecular Formula | C19H21F3N3O+ |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2S)-2-(4-phenylpiperazin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(F)c(F)c1F)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20F3N3O/c1-13(19(26)23-16-8-7-15(20)17(21)18(16)22)24-9-11-25(12-10-24)14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3,(H,23,26)/p+1/t13-/m0/s1 |
| InChIKey | XFGYRLXRFWKPMA-ZDUSSCGKSA-O |
| XLogP | 1.84 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|