C20H24ClFN3O+ — CID 9431499
(2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9431499) has the molecular formula C20H24ClFN3O+ and a molecular weight of 376.88 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9431499 |
| Molecular Formula | C20H24ClFN3O+ |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H](C)[NH+]1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H23ClFN3O/c1-14-3-4-16(21)13-19(14)23-20(26)15(2)24-9-11-25(12-10-24)18-7-5-17(22)6-8-18/h3-8,13,15H,9-12H2,1-2H3,(H,23,26)/p+1/t15-/m1/s1 |
| InChIKey | CPBDLZWNOFHBOR-OAHLLOKOSA-O |
| XLogP | 2.52 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |