C20H24FN4O3+ — CID 7390067
(2R)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide (PubChem CID 7390067) has the molecular formula C20H24FN4O3+ and a molecular weight of 387.44 g/mol. Its IUPAC name is (2R)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7390067 |
| Molecular Formula | C20H24FN4O3+ |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (2R)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)propanamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H](C)[NH+]1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H23FN4O3/c1-14-13-18(25(27)28)7-8-19(14)22-20(26)15(2)23-9-11-24(12-10-23)17-5-3-16(21)4-6-17/h3-8,13,15H,9-12H2,1-2H3,(H,22,26)/p+1/t15-/m1/s1 |
| InChIKey | SUSIVRBGCIWNQM-OAHLLOKOSA-O |
| XLogP | 1.77 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|