C21H26ClN4O5S+ — CID 2512145
(2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 2512145) has the molecular formula C21H26ClN4O5S+ and a molecular weight of 481.98 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 2512145 |
| Molecular Formula | C21H26ClN4O5S+ |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CC[NH+]([C@H](C)C(=O)Nc3cc([N+](=O)[O-])ccc3Cl)CC2)c1 |
| InChI | InChI=1S/C21H25ClN4O5S/c1-14-4-5-15(2)20(12-14)32(30,31)25-10-8-24(9-11-25)16(3)21(27)23-19-13-17(26(28)29)6-7-18(19)22/h4-7,12-13,16H,8-11H2,1-3H3,(H,23,27)/p+1/t16-/m1/s1 |
| InChIKey | ODADTVVUAADMAP-MRXNPFEDSA-O |
| XLogP | 1.78 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|