C19H22ClN4O4+ — CID 2518469
(2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 2518469) has the molecular formula C19H22ClN4O4+ and a molecular weight of 405.86 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 2518469 |
| Molecular Formula | C19H22ClN4O4+ |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (2R)-N-(2-chloro-5-nitrophenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)[NH+]1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C19H21ClN4O4/c1-13(19(26)21-18-12-15(24(27)28)4-7-17(18)20)22-8-10-23(11-9-22)14-2-5-16(25)6-3-14/h2-7,12-13,25H,8-11H2,1H3,(H,21,26)/p+1/t13-/m1/s1 |
| InChIKey | WPDMFZCUBMKEQO-CYBMUJFWSA-O |
| XLogP | 1.69 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|