C20H25ClN3O2+ — CID 9276854
(2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9276854) has the molecular formula C20H25ClN3O2+ and a molecular weight of 374.89 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9276854 |
| Molecular Formula | C20H25ClN3O2+ |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H](C)[NH+]1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-14-3-4-16(21)13-19(14)22-20(26)15(2)23-9-11-24(12-10-23)17-5-7-18(25)8-6-17/h3-8,13,15,25H,9-12H2,1-2H3,(H,22,26)/p+1/t15-/m1/s1 |
| InChIKey | GLGBYDYUAQQZFJ-OAHLLOKOSA-O |
| XLogP | 2.09 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |