C10H11BrClNO — CID 94063637
(2S)-2-bromo-N-(5-chloro-2-methylphenyl)propanamide (PubChem CID 94063637) has the molecular formula C10H11BrClNO and a molecular weight of 276.56 g/mol. Its IUPAC name is (2S)-2-bromo-N-(5-chloro-2-methylphenyl)propanamide.
| Compound Name | (2S)-2-bromo-N-(5-chloro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 94063637 |
| Molecular Formula | C10H11BrClNO |
| Molecular Weight | 276.56 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | (2S)-2-bromo-N-(5-chloro-2-methylphenyl)propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@H](C)Br |
| InChI | InChI=1S/C10H11BrClNO/c1-6-3-4-8(12)5-9(6)13-10(14)7(2)11/h3-5,7H,1-2H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | UKEYXKCDUNMFNC-ZETCQYMHSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|