C11H12ClN2O3- — CID 7679282
(2R)-2-[(5-chloro-2-methylphenyl)carbamoylamino]propanoate (PubChem CID 7679282) has the molecular formula C11H12ClN2O3- and a molecular weight of 255.68 g/mol. Its IUPAC name is (2R)-2-[(5-chloro-2-methylphenyl)carbamoylamino]propanoate.
| Compound Name | (2R)-2-[(5-chloro-2-methylphenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 7679282 |
| Molecular Formula | C11H12ClN2O3- |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (2R)-2-[(5-chloro-2-methylphenyl)carbamoylamino]propanoate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)N[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C11H13ClN2O3/c1-6-3-4-8(12)5-9(6)14-11(17)13-7(2)10(15)16/h3-5,7H,1-2H3,(H,15,16)(H2,13,14,17)/p-1/t7-/m1/s1 |
| InChIKey | PUMPPNOJDYXFLA-SSDOTTSWSA-M |
| XLogP | 0.91 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |