C16H16ClIN2O — CID 9431031
(2S)-N-(5-chloro-2-methylphenyl)-2-(4-iodoanilino)propanamide (PubChem CID 9431031) has the molecular formula C16H16ClIN2O and a molecular weight of 414.67 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-methylphenyl)-2-(4-iodoanilino)propanamide.
| Compound Name | (2S)-N-(5-chloro-2-methylphenyl)-2-(4-iodoanilino)propanamide |
|---|---|
| PubChem CID | 9431031 |
| Molecular Formula | C16H16ClIN2O |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (2S)-N-(5-chloro-2-methylphenyl)-2-(4-iodoanilino)propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@H](C)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H16ClIN2O/c1-10-3-4-12(17)9-15(10)20-16(21)11(2)19-14-7-5-13(18)6-8-14/h3-9,11,19H,1-2H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | UZOMVJWOCOXOJO-NSHDSACASA-N |
| XLogP | 4.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|