C19H20ClN3O3 — CID 46667088
N-(5-chloro-2-methylphenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanamide (PubChem CID 46667088) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanamide |
|---|---|
| PubChem CID | 46667088 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)amino]propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(C)Nc1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C19H20ClN3O3/c1-10-4-5-13(20)8-15(10)22-18(24)11(2)21-14-6-7-17-16(9-14)23-19(25)12(3)26-17/h4-9,11-12,21H,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | JGPDATZVSYFOMO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|