C18H25N3O3 — CID 25329669
(2S)-6-[[(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl]amino]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 25329669) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2S)-6-[[(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl]amino]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-6-[[(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl]amino]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 25329669 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (2S)-6-[[(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl]amino]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@H](Nc1ccc2c(c1)NC(=O)[C@H](C)O2)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C18H25N3O3/c1-12(18(23)21-9-5-3-4-6-10-21)19-14-7-8-16-15(11-14)20-17(22)13(2)24-16/h7-8,11-13,19H,3-6,9-10H2,1-2H3,(H,20,22)/t12-,13-/m0/s1 |
| InChIKey | SKGIGPRSRVQGMJ-STQMWFEESA-N |
| XLogP | 2.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|