C19H20N4O4 — CID 25356773
4-[[(2S)-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanoyl]amino]benzamide (PubChem CID 25356773) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-[[(2S)-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanoyl]amino]benzamide.
| Compound Name | 4-[[(2S)-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 25356773 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[[(2S)-2-[[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanoyl]amino]benzamide |
| SMILES | C[C@H](Nc1ccc2c(c1)NC(=O)[C@H](C)O2)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H20N4O4/c1-10(18(25)22-13-5-3-12(4-6-13)17(20)24)21-14-7-8-16-15(9-14)23-19(26)11(2)27-16/h3-11,21H,1-2H3,(H2,20,24)(H,22,25)(H,23,26)/t10-,11-/m0/s1 |
| InChIKey | CJEVXQVVXXBFKP-QWRGUYRKSA-N |
| XLogP | 1.94 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|