C26H24N4O3S — CID 41208500
(2R)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanamide (PubChem CID 41208500) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is (2R)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanamide.
| Compound Name | (2R)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanamide |
|---|---|
| PubChem CID | 41208500 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (2R)-N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-2-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]amino]propanamide |
| SMILES | C[C@@H](Nc1ccc2c(c1)NC(=O)[C@@H](C)O2)C(=O)Nc1ccc(Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C26H24N4O3S/c1-15(27-19-11-12-22-21(14-19)30-26(32)16(2)33-22)25(31)28-18-9-7-17(8-10-18)13-24-29-20-5-3-4-6-23(20)34-24/h3-12,14-16,27H,13H2,1-2H3,(H,28,31)(H,30,32)/t15-,16-/m1/s1 |
| InChIKey | ARIKWODZJPUOHV-HZPDHXFCSA-N |
| XLogP | 5.05 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|