C22H26N4O3 — CID 25328815
(2R)-2-methyl-6-[[(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]amino]-4H-1,4-benzoxazin-3-one (PubChem CID 25328815) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is (2R)-2-methyl-6-[[(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | (2R)-2-methyl-6-[[(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 25328815 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (2R)-2-methyl-6-[[(2R)-1-oxo-1-(4-phenylpiperazin-1-yl)propan-2-yl]amino]-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@@H](Nc1ccc2c(c1)NC(=O)[C@@H](C)O2)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N4O3/c1-15(23-17-8-9-20-19(14-17)24-21(27)16(2)29-20)22(28)26-12-10-25(11-13-26)18-6-4-3-5-7-18/h3-9,14-16,23H,10-13H2,1-2H3,(H,24,27)/t15-,16-/m1/s1 |
| InChIKey | BWXJSIDCMBRAFJ-HZPDHXFCSA-N |
| XLogP | 2.56 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|