C17H16FN3O2S — CID 8563794
1-(3-fluoro-4-methylphenyl)-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea (PubChem CID 8563794) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea |
|---|---|
| PubChem CID | 8563794 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc3c(c2)NC(=O)[C@@H](C)O3)cc1F |
| InChI | InChI=1S/C17H16FN3O2S/c1-9-3-4-11(7-13(9)18)19-17(24)20-12-5-6-15-14(8-12)21-16(22)10(2)23-15/h3-8,10H,1-2H3,(H,21,22)(H2,19,20,24)/t10-/m1/s1 |
| InChIKey | VUYMLDGMPIAFBG-SNVBAGLBSA-N |
| XLogP | 3.66 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|