C17H25N4O3S+ — CID 8563705
1-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 8563705) has the molecular formula C17H25N4O3S+ and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8563705 |
| Molecular Formula | C17H25N4O3S+ |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | C[C@H]1Oc2ccc(NC(=S)NCCC[NH+]3CCOCC3)cc2NC1=O |
| InChI | InChI=1S/C17H24N4O3S/c1-12-16(22)20-14-11-13(3-4-15(14)24-12)19-17(25)18-5-2-6-21-7-9-23-10-8-21/h3-4,11-12H,2,5-10H2,1H3,(H,20,22)(H2,18,19,25)/p+1/t12-/m1/s1 |
| InChIKey | XBVLVHMKZIWUKR-GFCCVEGCSA-O |
| XLogP | -0.00 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|