C16H22N4O4 — CID 18164565
6-(carbamoylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)hexanamide (PubChem CID 18164565) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-(carbamoylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)hexanamide.
| Compound Name | 6-(carbamoylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)hexanamide |
|---|---|
| PubChem CID | 18164565 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 6-(carbamoylamino)-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)hexanamide |
| SMILES | CC1Oc2ccc(NC(=O)CCCCCNC(N)=O)cc2NC1=O |
| InChI | InChI=1S/C16H22N4O4/c1-10-15(22)20-12-9-11(6-7-13(12)24-10)19-14(21)5-3-2-4-8-18-16(17)23/h6-7,9-10H,2-5,8H2,1H3,(H,19,21)(H,20,22)(H3,17,18,23) |
| InChIKey | KZLMZQRASYXTQV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|